CAS 1272754-93-4 is the registry number for (S)-5-(tert-Butoxy)-2-(methylamino)-5-oxopentanoic acid, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
(2S)-2-(methylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 1272754-93-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2S)-2-(methylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: XJBVKRGMBOGCPS-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2S)-2-(methylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | XJBVKRGMBOGCPS-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC |
Computed by PubChem (NCBI)