Products 1272754-93-4

CAS 1272754-93-4 is the registry number for (S)-5-(tert-Butoxy)-2-(methylamino)-5-oxopentanoic acid, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2S)-2-(methylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 1272754-93-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2S)-2-(methylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: XJBVKRGMBOGCPS-ZETCQYMHSA-N.

Identity
Molecular formulaC10H19NO4
Molecular weight217.26 g/mol
IUPAC name(2S)-2-(methylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
InChIKeyXJBVKRGMBOGCPS-ZETCQYMHSA-N
SMILESCC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC

Computed by PubChem (NCBI)