cas: 82586-62-7 — see every product listed under this CAS number, including other names
(S)-6,7-Dimethoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid, HCl, 98%+,RG, 98%+,RG (CAS 82586-62-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BTA-250mg |
| cas | 82586-62-7 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 25g | 2834.00 Pln |
| purity | 98%+,RG |
|---|---|
| delivery time | 3 weeks |
(3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride (CAS 82586-62-7) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: (3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride. InChIKey: ROWPWZMWICGKBY-FVGYRXGTSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | (3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | ROWPWZMWICGKBY-FVGYRXGTSA-N |
| SMILES | COC1=C(C=C2CN[C@@H](CC2=C1)C(=O)O)OC.Cl |
Computed by PubChem (NCBI)