CAS 78057-85-9 appears in our catalog under these names: D-Glutamic acid alpha-benzyl ester hydrochloride, 98%, H-D-Glu-Obzl.HCl, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
(4R)-4-amino-5-oxo-5-phenylmethoxypentanoic acid;hydrochloride (CAS 78057-85-9) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: (4R)-4-amino-5-oxo-5-phenylmethoxypentanoic acid;hydrochloride. InChIKey: HFWSBJVZQUWUNZ-HNCPQSOCSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | (4R)-4-amino-5-oxo-5-phenylmethoxypentanoic acid;hydrochloride |
| InChIKey | HFWSBJVZQUWUNZ-HNCPQSOCSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CCC(=O)O)N.Cl |
Computed by PubChem (NCBI)