cas: 82586-62-7 — see every product listed under this CAS number, including other names
(S)-(-)-6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic Acid Hydrochloride, >98.0%(HPLC)(T) (CAS 82586-62-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D4375-1G |
| cas | 82586-62-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 162.60 Pln | |
| TCI | 5g | 506.81 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
(3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride (CAS 82586-62-7) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: (3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride. InChIKey: ROWPWZMWICGKBY-FVGYRXGTSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | (3S)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | ROWPWZMWICGKBY-FVGYRXGTSA-N |
| SMILES | COC1=C(C=C2CN[C@@H](CC2=C1)C(=O)O)OC.Cl |
Computed by PubChem (NCBI)