CAS 2055114-59-3 appears in our catalog under these names: (2R,4R)-2-Amino-4-benzylpentanedioic acid hydrochloride, 95%, (2R,4R)–2–Amino–4–benzylpentanedioicacidhydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
(2R,4R)-2-amino-4-benzylpentanedioic acid;hydrochloride (CAS 2055114-59-3) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: (2R,4R)-2-amino-4-benzylpentanedioic acid;hydrochloride. InChIKey: YHPLSUDKIMKECP-DHTOPLTISA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | (2R,4R)-2-amino-4-benzylpentanedioic acid;hydrochloride |
| InChIKey | YHPLSUDKIMKECP-DHTOPLTISA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C[C@H](C(=O)O)N)C(=O)O.Cl |
Computed by PubChem (NCBI)