cas: 2411592-03-3 — see every product listed under this CAS number, including other names
(S)-6-Bromo-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride 95% (CAS 2411592-03-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1192263-50mg |
| cas | 2411592-03-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 220.19 Pln | |
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1638.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1192263 |
(1S)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2411592-03-3) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: (1S)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: FPTQDDKJLYZDHS-PPHPATTJSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | (1S)-6-bromo-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | FPTQDDKJLYZDHS-PPHPATTJSA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)