Products 1187385-56-3
CAS 1187385-56-3 appears in our catalog under these names: 1-(3-Bromophenyl)pyrrolidine hydrochloride, 1-(3-Bromophenyl)pyrrolidine hydrochloride, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
1-(3-bromophenyl)pyrrolidine;hydrochloride (CAS 1187385-56-3) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 1-(3-bromophenyl)pyrrolidine;hydrochloride. InChIKey: GYJHQYGVTRCCDK-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 1-(3-bromophenyl)pyrrolidine;hydrochloride |
| InChIKey | GYJHQYGVTRCCDK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)