cas: 110529-22-1 — see every product listed under this CAS number, including other names
(S)-Alpha,Alpha-Diphenylmethylprolinol 97% (CAS 110529-22-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A946252-250mg |
| cas | 110529-22-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 748.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A946252 |
[(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol (CAS 110529-22-1) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: [(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol. InChIKey: XIJAGFLYYNXCAB-KRWDZBQOSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | [(2S)-1-methylpyrrolidin-2-yl]-diphenylmethanol |
| InChIKey | XIJAGFLYYNXCAB-KRWDZBQOSA-N |
| SMILES | CN1CCC[C@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)