cas: 118507-50-9 — see every product listed under this CAS number, including other names
(S)-Benzyl (2-oxopyrrolidin-3-yl)carbamate, 95% (CAS 118507-50-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339572-100MG |
| cas | 118507-50-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 768.50 Pln | |
| Fluorochem | 250mg | 1122.54 Pln | |
| Fluorochem | 1g | 2674.08 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate (CAS 118507-50-9) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate. InChIKey: DAMJCWMGELCIMI-JTQLQIEISA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | benzyl N-[(3S)-2-oxopyrrolidin-3-yl]carbamate |
| InChIKey | DAMJCWMGELCIMI-JTQLQIEISA-N |
| SMILES | C1CNC(=O)[C@H]1NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)