Products 33600-67-8
CAS 33600-67-8 appears in our catalog under these names: 2-Amino-3-(6-methoxy-1h-indol-3-yl)propanoic acid, 95%, 2–Amino–3–(6–methoxy–1H–indol–3–yl)propanoic acid, H-DL-Trp(6-OMe)-OH 98%, 2-Amino-3-(6-methoxy-1H-indol-3-yl)propanoic Acid, ≥95%, ≥95%, 2-Amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid, >=95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid (CAS 33600-67-8) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid. InChIKey: ASMBUJRMSWTSLE-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-amino-3-(6-methoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | ASMBUJRMSWTSLE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)