Products 13500-24-8
CAS 13500-24-8 appears in our catalog under these names: 5-[(4-Methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione, 95%, 5-(4’-Methoxybenzyl)-5-methylhydantoin, 5-(4-Methoxybenzyl)-5-methylimidazolidine-2,4-dione, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-[(4-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione (CAS 13500-24-8) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 5-[(4-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione. InChIKey: KWLVVXBHGRDQMC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 5-[(4-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
| InChIKey | KWLVVXBHGRDQMC-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)