CAS 30742-60-0 appears in our catalog under these names: 5-Nitro-2-piperidinobenzenecarbaldehyde, 95%, 5-Nitro-2-piperidinobenzenecarbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
5-nitro-2-piperidin-1-ylbenzaldehyde (CAS 30742-60-0) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 5-nitro-2-piperidin-1-ylbenzaldehyde. InChIKey: WPONLEWKUHGAEI-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 5-nitro-2-piperidin-1-ylbenzaldehyde |
| InChIKey | WPONLEWKUHGAEI-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)