cas: 72776-05-7 — see every product listed under this CAS number, including other names
(S)-Benzyl 4-oxoazetidine-2-carboxylate 97% (CAS 72776-05-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A272141-250mg |
| cas | 72776-05-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 581.75 Pln | |
| Ambeed | 5g | 1371.62 Pln | |
| Ambeed | 10g | 2372.88 Pln | |
| Ambeed | 25g | 4681.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A272141 |
Benzyl (2S)-4-oxoazetidine-2-carboxylate (CAS 72776-05-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: benzyl (2S)-4-oxoazetidine-2-carboxylate. InChIKey: WGLLBHSIXLWVFU-VIFPVBQESA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | benzyl (2S)-4-oxoazetidine-2-carboxylate |
| InChIKey | WGLLBHSIXLWVFU-VIFPVBQESA-N |
| SMILES | C1[C@H](NC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)