cas: 4299-70-1 — see every product listed under this CAS number, including other names
(S)-Methyl 2-amino-3-(1H-indol-3-yl)propanoate, 95+%, 95+% (CAS 4299-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CAJH-100g |
| cas | 4299-70-1 |
| size | 100g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 12347.60 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 5g | 1278.80 Pln | |
| Chemat | 10g | 1979.60 Pln | |
| Chemat | 25g | 3707.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate (CAS 4299-70-1) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate. InChIKey: KCUNTYMNJVXYKZ-JTQLQIEISA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1H-indol-3-yl)propanoate |
| InChIKey | KCUNTYMNJVXYKZ-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=CC=CC=C21)N |
Computed by PubChem (NCBI)