cas: 1191996-99-2 — see every product listed under this CAS number, including other names
(S)-Methyl 2-amino-3-cyclopentylpropanoate hydrochloride, 98% (CAS 1191996-99-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233006-250MG |
| cas | 1191996-99-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1783.76 Pln | |
| Fluorochem | 1g | 4329.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-2-amino-3-cyclopentylpropanoate;hydrochloride (CAS 1191996-99-2) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl (2S)-2-amino-3-cyclopentylpropanoate;hydrochloride. InChIKey: RAGBLBBMRQLNKB-QRPNPIFTSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-cyclopentylpropanoate;hydrochloride |
| InChIKey | RAGBLBBMRQLNKB-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](CC1CCCC1)N.Cl |
Computed by PubChem (NCBI)