cas: 1142223-08-2 — see every product listed under this CAS number, including other names
(S)-Methyl 3-cyclopropyl-3-(3-hydroxyphenyl)propanoate 98% (CAS 1142223-08-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A874731-100mg |
| cas | 1142223-08-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1560.75 Pln | |
| Ambeed | 5g | 5282.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A874731 |
Methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate (CAS 1142223-08-2) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate. InChIKey: PXBFBXFVUPMAJK-LBPRGKRZSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | methyl (3S)-3-cyclopropyl-3-(3-hydroxyphenyl)propanoate |
| InChIKey | PXBFBXFVUPMAJK-LBPRGKRZSA-N |
| SMILES | COC(=O)C[C@@H](C1CC1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)