cas: 4976-88-9 — see every product listed under this CAS number, including other names
(S)-Methyl 5-amino-2-((tert-butoxycarbonyl)amino)-5-oxopentanoate 97% (CAS 4976-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A372960-100mg |
| cas | 4976-88-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 3902.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A372960 |
Methyl (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (CAS 4976-88-9) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: methyl (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate. InChIKey: QEKBLYGUGNADLL-ZETCQYMHSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | methyl (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| InChIKey | QEKBLYGUGNADLL-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)C(=O)OC |
Computed by PubChem (NCBI)