CAS 336182-06-0 appears in our catalog under these names: Boc-l-beta-homoglutamine, 97%, Boc–β–homo–Gln–OH, Boc–?–HoGln–OH, Boc-β-HoGln-OH 97%, Boc-β-HoGln-OH, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100g, 25g, 5g, 100mg.
(3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid (CAS 336182-06-0) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid. InChIKey: DAUHTFNYHSOVRQ-ZETCQYMHSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid |
| InChIKey | DAUHTFNYHSOVRQ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)