CAS 446847-77-4 is the registry number for N2-(tert-Butoxycarbonyl)-N2-methyl-L-glutamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5-amino-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoic acid (CAS 446847-77-4) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (2S)-5-amino-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoic acid. InChIKey: UEXFOLGIHMVXKM-ZETCQYMHSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (2S)-5-amino-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoic acid |
| InChIKey | UEXFOLGIHMVXKM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)