CAS 27317-69-7 appears in our catalog under these names: N-Boc-L-alanyl-L-alanine, Boc–Ala–Ala–OH, (tert-Butoxycarbonyl)-L-alanyl-L-alanine, >98.0%(HPLC), Boc-Ala-Ala-OH, Boc-Ala-Ala-OH 97%. Offered by: TRC, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 500mg, 10g, 100g, 25g, 5g, 2g.
(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid (CAS 27317-69-7) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid. InChIKey: BZNDDHWTEVCBAD-BQBZGAKWSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoic acid |
| InChIKey | BZNDDHWTEVCBAD-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)