cas: 288617-73-2 — see every product listed under this CAS number, including other names
(S)-N-Fmoc-2-(4-Pentenyl)Alanine, 98%, 98% (CAS 288617-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WVC-100mg |
| cas | 288617-73-2 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 597.20 Pln | |
| Chemat | 10g | 1062.80 Pln | |
| Chemat | 25g | 2474.00 Pln | |
| Chemat | 50g | 4542.80 Pln | |
| Chemat | 250g | 10389.20 Pln | |
| Chemat | 500g | 19320.00 Pln | |
| Chemat | 1kg | 35618.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid (CAS 288617-73-2) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid. InChIKey: MRJFPZWLOJOINV-QHCPKHFHSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-enoic acid |
| InChIKey | MRJFPZWLOJOINV-QHCPKHFHSA-N |
| SMILES | C[C@](CCCC=C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)