cas: 130309-35-2 — see every product listed under this CAS number, including other names
(S)-N-Fmoc-2-Thienylalanine, 98%, 98% (CAS 130309-35-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111U00-100mg |
| cas | 130309-35-2 |
| size | 100mg |
| availability | 137g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 1029.20 Pln | |
| Chemat | 50g | 1782.80 Pln | |
| Chemat | 100g | 3165.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid (CAS 130309-35-2) is a chemical compound with the molecular formula C22H19NO4S and a molecular weight of 393.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: PXBMQFMUHRNKTG-FQEVSTJZSA-N.
| Molecular formula | C22H19NO4S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | PXBMQFMUHRNKTG-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=CS4)C(=O)O |
Computed by PubChem (NCBI)