CAS 130309-35-2 appears in our catalog under these names: Fmoc–β–(2–thienyl)–Ala–OH, Fmoc-L-Ala(2-Thienyl)-OH, Fmoc-b-(2-thienyl)-L-alanine, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(thiophen-2-yl)propanoic acid, 95%, Fmoc-3-Ala(2-thienyl)-OH 95%. Offered by: GLPBio, Iris Biotech, Biosynth, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 25g, 5g, 100g, 250mg, 100mg, 50g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid (CAS 130309-35-2) is a chemical compound with the molecular formula C22H19NO4S and a molecular weight of 393.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: PXBMQFMUHRNKTG-FQEVSTJZSA-N.
| Molecular formula | C22H19NO4S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | PXBMQFMUHRNKTG-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=CS4)C(=O)O |
Computed by PubChem (NCBI)