CAS 201532-42-5 appears in our catalog under these names: Fmoc–β–(2–thienyl)–D–Ala–OH, Fmoc-D-Ala(2-Thienyl)-OH, Fmoc-D-3-(2-Thienyl)-Ala-OH 96%, (R)-2-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]-3-(thiophen-2-yl)propanoic acid, 98%, 98%, Fmoc-D-Thi-OH, 99.73%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 25g, 100g, 250mg, 10g, 100mg, 1 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid (CAS 201532-42-5) is a chemical compound with the molecular formula C22H19NO4S and a molecular weight of 393.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: PXBMQFMUHRNKTG-HXUWFJFHSA-N.
| Molecular formula | C22H19NO4S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | PXBMQFMUHRNKTG-HXUWFJFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=CS4)C(=O)O |
Computed by PubChem (NCBI)