CAS 282525-12-6 is the registry number for 3-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}-3-(thiophen-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid (CAS 282525-12-6) is a chemical compound with the molecular formula C22H19NO4S and a molecular weight of 393.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: OTFVOIGWAZDVSI-UHFFFAOYSA-N.
| Molecular formula | C22H19NO4S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | OTFVOIGWAZDVSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC=CS4 |
Computed by PubChem (NCBI)