CAS 147127-19-3 appears in our catalog under these names: (S)-Tenofovir, (S)-Tenofovir, >95% (HPLC), (S)-Tenofovir/ 98.74% (existing batch purity), (S)–Tenofovir, (S)-(((1-(6-Amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonic acid, 98%, 98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 250mg, 25mg, 1mg, 2mg, 5mg, 10mg, 50mg.
[(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid (CAS 147127-19-3) is a chemical compound with the molecular formula C9H14N5O4P and a molecular weight of 287.21 g/mol. IUPAC name: [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid. InChIKey: SGOIRFVFHAKUTI-LURJTMIESA-N.
| Molecular formula | C9H14N5O4P |
|---|---|
| Molecular weight | 287.21 g/mol |
| IUPAC name | [(2S)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid |
| InChIKey | SGOIRFVFHAKUTI-LURJTMIESA-N |
| SMILES | C[C@@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)O |
Computed by PubChem (NCBI)