cas: 131690-60-3 — see every product listed under this CAS number, including other names
(S)-beta-(p-Chlorophenyl)alanine, 97% (CAS 131690-60-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040515-250MG |
| cas | 131690-60-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 919.49 Pln | |
| Fluorochem | 10g | 1434.93 Pln | |
| Fluorochem | 25g | 2845.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-amino-3-(4-chlorophenyl)propanoic acid (CAS 131690-60-3) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (3S)-3-amino-3-(4-chlorophenyl)propanoic acid. InChIKey: BXGDBHAMTMMNTO-QMMMGPOBSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-chlorophenyl)propanoic acid |
| InChIKey | BXGDBHAMTMMNTO-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)Cl |
Computed by PubChem (NCBI)