cas: 81323-58-2 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate, 95%+, 95%+ (CAS 81323-58-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119MOP-100mg |
| cas | 81323-58-2 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1648.40 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 25g | 5574.80 Pln | |
| Chemat | 50g | 6477.20 Pln | |
| Chemat | 100g | 9285.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 81323-58-2) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: tert-butyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: WFSWHDJTFHDJFE-VIFPVBQESA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | tert-butyl (2S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | WFSWHDJTFHDJFE-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCO)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)