CAS 201217-86-9 appears in our catalog under these names: Boc–D–Thr(tBu)–OH, Boc-O-tert-butyl-D-threonine, 97%, 97%, Boc-D-Thr(tBu)-OH, 97%, Boc-D-Thr(tBu)-OH, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 100g.
(2R,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 201217-86-9) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: (2R,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LKRXXARJBFBMCE-DTWKUNHWSA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | (2R,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LKRXXARJBFBMCE-DTWKUNHWSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)