CAS 66967-01-9 is the registry number for Boc-epi-statine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
(3R,4S)-3-hydroxy-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (CAS 66967-01-9) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: (3R,4S)-3-hydroxy-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid. InChIKey: KJIQRHBVNGRPCO-VHSXEESVSA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | (3R,4S)-3-hydroxy-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
| InChIKey | KJIQRHBVNGRPCO-VHSXEESVSA-N |
| SMILES | CC(C)C[C@@H]([C@@H](CC(=O)O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)