CAS 96637-65-9 is the registry number for (S)-Methyl 3-tert-butoxy-2-(tert-butoxycarbonylamino)propanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Methyl (2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 96637-65-9) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: methyl (2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: BVZNGDRSVMZTHF-VIFPVBQESA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | methyl (2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | BVZNGDRSVMZTHF-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)