CAS 1381959-73-4 appears in our catalog under these names: (S)-tert-Butyl 2-tert-butylpiperazine-1-carboxylate hydrochloride, 95%, (S)–tert–Butyl 2–(tert–butyl)piperazine–1–carboxylate hydrochloride, (S)-tert-Butyl 2-(tert-butyl)piperazine-1-carboxylate hydrochloride, 97%, 97%, (S)-tert-Butyl 2-(tert-butyl)piperazine-1-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl (2S)-2-tert-butylpiperazine-1-carboxylate;hydrochloride (CAS 1381959-73-4) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl (2S)-2-tert-butylpiperazine-1-carboxylate;hydrochloride. InChIKey: ADQLANUYQADSBC-HNCPQSOCSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl (2S)-2-tert-butylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | ADQLANUYQADSBC-HNCPQSOCSA-N |
| SMILES | CC(C)(C)[C@H]1CNCCN1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)