cas: 119483-45-3 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-amino-3,3-dimethylbutanoate hydrochloride, 97%, 97% (CAS 119483-45-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IV1-10g |
| cas | 119483-45-3 |
| size | 10g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 443.60 Pln | |
| Chemat | 25g | 1019.60 Pln | |
| Chemat | 100g | 2685.20 Pln | |
| Chemat | 500g | 9345.60 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 251.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride (CAS 119483-45-3) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride. InChIKey: OOJKHARXMDMOCG-OGFXRTJISA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride |
| InChIKey | OOJKHARXMDMOCG-OGFXRTJISA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)