Products 72808-57-2

CAS 72808-57-2 is the registry number for Methyl 9-aminononanoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 9-aminononanoate;hydrochloride (CAS 72808-57-2) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: methyl 9-aminononanoate;hydrochloride. InChIKey: LPFAJVWTUCBBRE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22ClNO2
Molecular weight223.74 g/mol
IUPAC namemethyl 9-aminononanoate;hydrochloride
InChIKeyLPFAJVWTUCBBRE-UHFFFAOYSA-N
SMILESCOC(=O)CCCCCCCCN.Cl

Computed by PubChem (NCBI)