CAS 2748-02-9 appears in our catalog under these names: H-Leu-OtBu hydrochloride, 98%, H–Leu–OtBu·HCl, H–Leu–OtBu (hydrochloride), H-L-Leu-OtBu*HCl, L-Leucine tert-butyl ester hydrochloride, 98% . Offered by: Combi-blocks, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100g, 25g, 5g, 500g, 1g, 10g, 100 g, 500 g.
Tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride (CAS 2748-02-9) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride. InChIKey: RFUWRXIYTQGFGA-QRPNPIFTSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4-methylpentanoate;hydrochloride |
| InChIKey | RFUWRXIYTQGFGA-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)