CAS 256478-92-9 appears in our catalog under these names: tert-Butyl (2r)-2-amino-3,3-dimethylbutanoate hydrochloride, 95%, tert-Butyl (R)-2-amino-3,3-dimethylbutanoate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Tert-butyl (2R)-2-amino-3,3-dimethylbutanoate;hydrochloride (CAS 256478-92-9) is a chemical compound with the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3,3-dimethylbutanoate;hydrochloride. InChIKey: OOJKHARXMDMOCG-FJXQXJEOSA-N.
| Molecular formula | C10H22ClNO2 |
|---|---|
| Molecular weight | 223.74 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3,3-dimethylbutanoate;hydrochloride |
| InChIKey | OOJKHARXMDMOCG-FJXQXJEOSA-N |
| SMILES | CC(C)(C)[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)