cas: 17083-23-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-amino-3-(4-(tert-butoxy)phenyl)propanoate hydrochloride, 95% (CAS 17083-23-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223978-1G |
| cas | 17083-23-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 726.85 Pln | |
| Fluorochem | 25g | 1450.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride (CAS 17083-23-7) is a chemical compound with the molecular formula C17H28ClNO3 and a molecular weight of 329.9 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride. InChIKey: ZAHGOULTAJWDGV-UQKRIMTDSA-N.
| Molecular formula | C17H28ClNO3 |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride |
| InChIKey | ZAHGOULTAJWDGV-UQKRIMTDSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)