cas: 17083-23-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-amino-3-(4-(tert-butoxy)phenyl)propanoate hydrochloride, 97%, 97% (CAS 17083-23-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114716-250mg |
| cas | 17083-23-7 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 491.60 Pln | |
| Chemat | 25g | 933.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride (CAS 17083-23-7) is a chemical compound with the molecular formula C17H28ClNO3 and a molecular weight of 329.9 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride. InChIKey: ZAHGOULTAJWDGV-UQKRIMTDSA-N.
| Molecular formula | C17H28ClNO3 |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride |
| InChIKey | ZAHGOULTAJWDGV-UQKRIMTDSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)