cas: 1589082-06-3 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-(cyanomethyl)piperazine-1-carboxylate 97% (CAS 1589082-06-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A332826-10g |
| cas | 1589082-06-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 6355.62 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 926.62 Pln | |
| Ambeed | 5g | 3997.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A332826 |
Tert-butyl (3S)-3-(cyanomethyl)piperazine-1-carboxylate (CAS 1589082-06-3) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl (3S)-3-(cyanomethyl)piperazine-1-carboxylate. InChIKey: PQMGXPIFQIFJEX-VIFPVBQESA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl (3S)-3-(cyanomethyl)piperazine-1-carboxylate |
| InChIKey | PQMGXPIFQIFJEX-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)CC#N |
Computed by PubChem (NCBI)