(S)-tert-Butyl 4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%, 98%
cas: 1206227-45-3 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%, 98% (CAS 1206227-45-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119WA2-100mg |
| cas | 1206227-45-3 |
| size | 100mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 500mg | 458.00 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3707.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4S)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1206227-45-3) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl (4S)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: HSGFAURARADKGN-MRVPVSSYSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl (4S)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | HSGFAURARADKGN-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
(4S)-4-t-Butyl-1,2,3-oxathiazolidine-2,2-dioxide-3-carboxylic acid t-butyl ester, (S)-tert-Butyl 4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, (S)-3-Boc-4-tert-butyl-2,2-dioxo-[1,2,3]oxathiazolidine, (S)-3-Boc-4-(tert-butyl)-1,2,3-oxathiazolidine 2,2-dioxide, tert-butyl (4S)-4-tert-butyl-2,2-dioxo-oxathiazolidine-3-carboxylate, tert-butyl (S)-4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, tert-butyl (4S)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate, (S)-tert-Butyl4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate2,2-dioxide