cas: 1206227-45-3 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98% (CAS 1206227-45-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869644-100MG |
| cas | 1206227-45-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 500mg | 596.68 Pln | |
| Fluorochem | 1g | 877.83 Pln | |
| Fluorochem | 5g | 2825.06 Pln | |
| Fluorochem | 10g | 4730.64 Pln | |
| Fluorochem | 25g | 9869.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (4S)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1206227-45-3) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl (4S)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: HSGFAURARADKGN-MRVPVSSYSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl (4S)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | HSGFAURARADKGN-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[C@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)