cas: 324519-68-8 — see every product listed under this CAS number, including other names
(S,E)-5-Chloro-2-isopropyl-N,N-dimethylpent-4-enamide, 98+% (CAS 324519-68-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A769711-100mg |
| cas | 324519-68-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1066.03 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E,2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide (CAS 324519-68-8) is a chemical compound with the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. IUPAC name: (E,2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide. InChIKey: MFPMAEZQAUDONN-IWGCBNPKSA-N.
| Molecular formula | C10H18ClNO |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | (E,2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide |
| InChIKey | MFPMAEZQAUDONN-IWGCBNPKSA-N |
| SMILES | CC(C)[C@H](C/C=C/Cl)C(=O)N(C)C |
Computed by PubChem (NCBI)