CAS 324519-68-8 appears in our catalog under these names: (2S,4E)-5-Chloro-n,n-dimethyl-2-(1-methylethyl)-4-pentenamide, 95%, (S,E)-5-Chloro-2-isopropyl-N,N-dimethylpent-4-enamide, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
(E,2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide (CAS 324519-68-8) is a chemical compound with the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. IUPAC name: (E,2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide. InChIKey: MFPMAEZQAUDONN-IWGCBNPKSA-N.
| Molecular formula | C10H18ClNO |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | (E,2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide |
| InChIKey | MFPMAEZQAUDONN-IWGCBNPKSA-N |
| SMILES | CC(C)[C@H](C/C=C/Cl)C(=O)N(C)C |
Computed by PubChem (NCBI)