CAS 6240-03-5 is the registry number for 3-Amino-1-adamantanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-aminoadamantan-1-ol;hydrochloride (CAS 6240-03-5) is a chemical compound with the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. IUPAC name: 3-aminoadamantan-1-ol;hydrochloride. InChIKey: WFZANDIUEAIFSK-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | 3-aminoadamantan-1-ol;hydrochloride |
| InChIKey | WFZANDIUEAIFSK-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)O)N.Cl |
Computed by PubChem (NCBI)