CAS 2551116-94-8 is the registry number for 2,2-Dimethyl-1-(5-methylfuran-2-yl)propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
2,2-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride (CAS 2551116-94-8) is a chemical compound with the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. IUPAC name: 2,2-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride. InChIKey: BJFVIVHEQCLSHF-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | 2,2-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine;hydrochloride |
| InChIKey | BJFVIVHEQCLSHF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C(C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)