cas: 2448-58-0 — see every product listed under this CAS number, including other names
(tert-Butoxycarbonyl)-L-alanyl-L-phenylalanine, 95%, 95% (CAS 2448-58-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OAB-250mg |
| cas | 2448-58-0 |
| size | 250mg |
| availability | 9.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 909.20 Pln | |
| Chemat | 5g | 2608.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoic acid (CAS 2448-58-0) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoic acid. InChIKey: VAMUDINSUBSTNS-AAEUAGOBSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | VAMUDINSUBSTNS-AAEUAGOBSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)