CAS 138227-68-6 appears in our catalog under these names: 1N-Boc 4-(2'-methyl-4'-nitrophenoxy) piperidine, 95%, tert-Butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate (CAS 138227-68-6) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate. InChIKey: YNMNCFUFQJZIFY-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | tert-butyl 4-(2-methyl-4-nitrophenoxy)piperidine-1-carboxylate |
| InChIKey | YNMNCFUFQJZIFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])OC2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)