CAS 2448-58-0 appears in our catalog under these names: Boc-Ala-Phe-OH, 96%, Boc–Ala–Phe–OH, (tert-Butoxycarbonyl)-L-alanyl-L-phenylalanine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoic acid (CAS 2448-58-0) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoic acid. InChIKey: VAMUDINSUBSTNS-AAEUAGOBSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | VAMUDINSUBSTNS-AAEUAGOBSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)