Products 24959-68-0

CAS 24959-68-0 appears in our catalog under these names: Z-Ala-leu-oh, 95%, (S)-2-((S)-2-(((Benzyloxy)carbonyl)amino)propanamido)-4-methylpentanoic acid, 98%, Z–Ala–Leu–OH, Z-Ala-Leu-OH, Z-ALA-LEU-OH, 98%(LC-MS),RG, 98%(LC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 50g.

Structural formula: {0} (CAS {1})

4-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid (CAS 24959-68-0) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: 4-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid. InChIKey: YRQTWFBFEXBEQX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O5
Molecular weight336.4 g/mol
IUPAC name4-methyl-2-[2-(phenylmethoxycarbonylamino)propanoylamino]pentanoic acid
InChIKeyYRQTWFBFEXBEQX-UHFFFAOYSA-N
SMILESCC(C)CC(C(=O)O)NC(=O)C(C)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)